Chords for LITTLE WILLIE JOHN Spasms KING

_ [F] _ _ _ _ [Bb] _ _ _
_ [Eb] _ _ _ [G] _ _ _ _
_ [Eb] When [Ab] I saw your _ smiling face [Ebm] _ Spreading joy all over [C] the place
[Ab] I said _ _ _ _ [Eb] _
_ _ _ _ _ oooohh _
[G] _ [F] _ Please save [Bb] me from going _ [Eb] crazy
[B] cause you're giving [Eb] me spasms baby
Went [Eb] to the doctor
[Ab] the doctor said
[Eb] _ without your love I'd assume he dead
[Ab] I [Cm] said, _ ooo-oo-oo-oo [Eb]-oo-oo-oo-oo-oo-oo-oo-oo-oo-oo [F]-oooe
[Ab] Please save [Bb] me [G] from going [Eb] crazy
_ Cause, you're giving me specimens [Ab] baby
Oh what a fit, I always get
[G] When you [Bb] touch my [Eb] second _ [Ab] hand
If you tell me this [Ebm] ain't a lie
[Dm] I [G] know right away you don't [Bb] understand
_ [Eb] You [B] kissed me once, [Ab] hmm, I [Eb] asked for more
You kissed me twice, woo, [Ebm] hit the floor
I [F] said, woo, _ [Ab] _ _ _
_ [Eb] _ _ _ _ _ [Cm] you _ [G] _ _ saved [Bb] me from going [Eb] crazy
You're [Ebm] giving me smiles, I'm excited
_ _ _ _ [Ab] _ _ _
_ [Eb] _ _ _ _ _ _ _
[Ab] _ _ [B] _ _ _ [Ab] _ _ _
_ [Eb] _ _ _ _ _ _ _
_ [F] _ _ _ _ [Bb] _ _ [G] _
_ [Eb] _ _ _ [G] _ _ _
[Eb] Oh, what [Gm] a pick [Ab] I always get
_ When you touch my shaking _ hand
If [F] you tell me this ain't love, I know right away you [Bb] don't understand.
_ [Eb] You [Gb] squeeze me tighter, [Ab] I [Db] get the feeling.
[Eb] You squeeze me tighter, and [Ebm] I need to feel it.
I [Ab] said _ ooh, _ ooh, [Eb] _ ooh, ooh, ooh, ooh, ooh, ooh, ooh, ooh, [F] ooh, ooh, ooh.
[Ab] Please save [Bb] me from going _ crazy.
[N] Ah, you're giving me spasms,